C19H23ClN3+ — CID 6880210
(E)-1-(3-chlorophenyl)-N-[4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]methanimine (PubChem CID 6880210) has the molecular formula C19H23ClN3+ and a molecular weight of 328.87 g/mol. Its IUPAC name is (E)-1-(3-chlorophenyl)-N-[4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]methanimine.
| Compound Name | (E)-1-(3-chlorophenyl)-N-[4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]methanimine |
|---|---|
| PubChem CID | 6880210 |
| Molecular Formula | C19H23ClN3+ |
| Molecular Weight | 328.87 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (E)-1-(3-chlorophenyl)-N-[4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]methanimine |
| SMILES | Cc1ccc(C[NH+]2CCN(/N=C/c3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C19H22ClN3/c1-16-5-7-17(8-6-16)15-22-9-11-23(12-10-22)21-14-18-3-2-4-19(20)13-18/h2-8,13-14H,9-12,15H2,1H3/p+1/b21-14+ |
| InChIKey | BBCJATHFFDATNK-KGENOOAVSA-O |
| XLogP | 2.38 |
| TPSA | 20.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.87 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|