C20H24Cl2N3+ — CID 7745954
(Z)-1-(2,4-dichlorophenyl)-N-[4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]ethanimine (PubChem CID 7745954) has the molecular formula C20H24Cl2N3+ and a molecular weight of 377.34 g/mol. Its IUPAC name is (Z)-1-(2,4-dichlorophenyl)-N-[4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]ethanimine.
| Compound Name | (Z)-1-(2,4-dichlorophenyl)-N-[4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]ethanimine |
|---|---|
| PubChem CID | 7745954 |
| Molecular Formula | C20H24Cl2N3+ |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (Z)-1-(2,4-dichlorophenyl)-N-[4-[(4-methylphenyl)methyl]piperazin-4-ium-1-yl]ethanimine |
| SMILES | C/C(=N/N1CC[NH+](Cc2ccc(C)cc2)CC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H23Cl2N3/c1-15-3-5-17(6-4-15)14-24-9-11-25(12-10-24)23-16(2)19-8-7-18(21)13-20(19)22/h3-8,13H,9-12,14H2,1-2H3/p+1/b23-16- |
| InChIKey | JNJIZEMOEBEWJC-KQWNVCNZSA-O |
| XLogP | 3.43 |
| TPSA | 20.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|