C23H25ClN3+ — CID 7422706
(E)-N-[4-[(4-chlorophenyl)methyl]piperazin-4-ium-1-yl]-1-naphthalen-2-ylethanimine (PubChem CID 7422706) has the molecular formula C23H25ClN3+ and a molecular weight of 378.93 g/mol. Its IUPAC name is (E)-N-[4-[(4-chlorophenyl)methyl]piperazin-4-ium-1-yl]-1-naphthalen-2-ylethanimine.
| Compound Name | (E)-N-[4-[(4-chlorophenyl)methyl]piperazin-4-ium-1-yl]-1-naphthalen-2-ylethanimine |
|---|---|
| PubChem CID | 7422706 |
| Molecular Formula | C23H25ClN3+ |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (E)-N-[4-[(4-chlorophenyl)methyl]piperazin-4-ium-1-yl]-1-naphthalen-2-ylethanimine |
| SMILES | C/C(=N\N1CC[NH+](Cc2ccc(Cl)cc2)CC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H24ClN3/c1-18(21-9-8-20-4-2-3-5-22(20)16-21)25-27-14-12-26(13-15-27)17-19-6-10-23(24)11-7-19/h2-11,16H,12-15,17H2,1H3/p+1/b25-18+ |
| InChIKey | SPHNQPCBXMOEGX-XIEYBQDHSA-O |
| XLogP | 3.62 |
| TPSA | 20.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|