C23H26N3+ — CID 4746624
4-benzyl-N-(1-naphthalen-2-ylethenyl)piperazin-4-ium-1-amine (PubChem CID 4746624) has the molecular formula C23H26N3+ and a molecular weight of 344.48 g/mol. Its IUPAC name is 4-benzyl-N-(1-naphthalen-2-ylethenyl)piperazin-4-ium-1-amine.
| Compound Name | 4-benzyl-N-(1-naphthalen-2-ylethenyl)piperazin-4-ium-1-amine |
|---|---|
| PubChem CID | 4746624 |
| Molecular Formula | C23H26N3+ |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 4-benzyl-N-(1-naphthalen-2-ylethenyl)piperazin-4-ium-1-amine |
| SMILES | C=C(NN1CC[NH+](Cc2ccccc2)CC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H25N3/c1-19(22-12-11-21-9-5-6-10-23(21)17-22)24-26-15-13-25(14-16-26)18-20-7-3-2-4-8-20/h2-12,17,24H,1,13-16,18H2/p+1 |
| InChIKey | GWJXWTFHAGWWMW-UHFFFAOYSA-O |
| XLogP | 2.72 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |