C19H23ClN3O+ — CID 5098999
4-[1-[[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]amino]ethenyl]phenol (PubChem CID 5098999) has the molecular formula C19H23ClN3O+ and a molecular weight of 344.87 g/mol. Its IUPAC name is 4-[1-[[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]amino]ethenyl]phenol.
| Compound Name | 4-[1-[[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]amino]ethenyl]phenol |
|---|---|
| PubChem CID | 5098999 |
| Molecular Formula | C19H23ClN3O+ |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 4-[1-[[4-[(2-chlorophenyl)methyl]piperazin-4-ium-1-yl]amino]ethenyl]phenol |
| SMILES | C=C(NN1CC[NH+](Cc2ccccc2Cl)CC1)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H22ClN3O/c1-15(16-6-8-18(24)9-7-16)21-23-12-10-22(11-13-23)14-17-4-2-3-5-19(17)20/h2-9,21,24H,1,10-14H2/p+1 |
| InChIKey | XYSRBDJFHUOFGG-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 39.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |