C17H21ClN3O+ — CID 4126834
4-[(4-chlorophenyl)methyl]-N-[1-(furan-2-yl)ethenyl]piperazin-4-ium-1-amine (PubChem CID 4126834) has the molecular formula C17H21ClN3O+ and a molecular weight of 318.83 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl]-N-[1-(furan-2-yl)ethenyl]piperazin-4-ium-1-amine.
| Compound Name | 4-[(4-chlorophenyl)methyl]-N-[1-(furan-2-yl)ethenyl]piperazin-4-ium-1-amine |
|---|---|
| PubChem CID | 4126834 |
| Molecular Formula | C17H21ClN3O+ |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl]-N-[1-(furan-2-yl)ethenyl]piperazin-4-ium-1-amine |
| SMILES | C=C(NN1CC[NH+](Cc2ccc(Cl)cc2)CC1)c1ccco1 |
| InChI | InChI=1S/C17H20ClN3O/c1-14(17-3-2-12-22-17)19-21-10-8-20(9-11-21)13-15-4-6-16(18)7-5-15/h2-7,12,19H,1,8-11,13H2/p+1 |
| InChIKey | ATZSNGPBBZJUNL-UHFFFAOYSA-O |
| XLogP | 1.81 |
| TPSA | 32.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |