C16H19ClN3O+ — CID 2143736
N-[4-[(4-chlorophenyl)methyl]piperazin-4-ium-1-yl]-1-(furan-2-yl)methanimine (PubChem CID 2143736) has the molecular formula C16H19ClN3O+ and a molecular weight of 304.80 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)methyl]piperazin-4-ium-1-yl]-1-(furan-2-yl)methanimine.
| Compound Name | N-[4-[(4-chlorophenyl)methyl]piperazin-4-ium-1-yl]-1-(furan-2-yl)methanimine |
|---|---|
| PubChem CID | 2143736 |
| Molecular Formula | C16H19ClN3O+ |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[4-[(4-chlorophenyl)methyl]piperazin-4-ium-1-yl]-1-(furan-2-yl)methanimine |
| SMILES | Clc1ccc(C[NH+]2CCN(N=Cc3ccco3)CC2)cc1 |
| InChI | InChI=1S/C16H18ClN3O/c17-15-5-3-14(4-6-15)13-19-7-9-20(10-8-19)18-12-16-2-1-11-21-16/h1-6,11-12H,7-10,13H2/p+1 |
| InChIKey | RXWGSSPLWHKDPQ-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 33.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|