C14H17N5O4 — CID 5100215
1-[5-(1-hydroxyethyl)-4-[1-(3-nitrophenyl)ethylideneamino]-1,2,4-triazol-3-yl]ethanol (PubChem CID 5100215) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is 1-[5-(1-hydroxyethyl)-4-[1-(3-nitrophenyl)ethylideneamino]-1,2,4-triazol-3-yl]ethanol.
| Compound Name | 1-[5-(1-hydroxyethyl)-4-[1-(3-nitrophenyl)ethylideneamino]-1,2,4-triazol-3-yl]ethanol |
|---|---|
| PubChem CID | 5100215 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 1-[5-(1-hydroxyethyl)-4-[1-(3-nitrophenyl)ethylideneamino]-1,2,4-triazol-3-yl]ethanol |
| SMILES | CC(=Nn1c(C(C)O)nnc1C(C)O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H17N5O4/c1-8(11-5-4-6-12(7-11)19(22)23)17-18-13(9(2)20)15-16-14(18)10(3)21/h4-7,9-10,20-21H,1-3H3 |
| InChIKey | PUKOSYJCLNPEBZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 126.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|