C10H17BrN4S+2 — CID 8007592
[4-[(5-bromothiophen-2-yl)methyl]piperazine-1,4-diium-1-ylidene]methanediamine (PubChem CID 8007592) has the molecular formula C10H17BrN4S+2 and a molecular weight of 305.24 g/mol. Its IUPAC name is [4-[(5-bromothiophen-2-yl)methyl]piperazine-1,4-diium-1-ylidene]methanediamine.
| Compound Name | [4-[(5-bromothiophen-2-yl)methyl]piperazine-1,4-diium-1-ylidene]methanediamine |
|---|---|
| PubChem CID | 8007592 |
| Molecular Formula | C10H17BrN4S+2 |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | [4-[(5-bromothiophen-2-yl)methyl]piperazine-1,4-diium-1-ylidene]methanediamine |
| SMILES | NC(N)=[N+]1CC[NH+](Cc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C10H15BrN4S/c11-9-2-1-8(16-9)7-14-3-5-15(6-4-14)10(12)13/h1-2H,3-7H2,(H3,12,13)/p+2 |
| InChIKey | FCUJORAHAWWONK-UHFFFAOYSA-P |
| XLogP | -0.81 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|