C20H24FN6S+ — CID 9242751
1-(3,4-dimethylphenyl)-4-[[4-(4-fluorophenyl)piperazin-1-ium-1-yl]methyl]tetrazole-5-thione (PubChem CID 9242751) has the molecular formula C20H24FN6S+ and a molecular weight of 399.52 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-4-[[4-(4-fluorophenyl)piperazin-1-ium-1-yl]methyl]tetrazole-5-thione.
| Compound Name | 1-(3,4-dimethylphenyl)-4-[[4-(4-fluorophenyl)piperazin-1-ium-1-yl]methyl]tetrazole-5-thione |
|---|---|
| PubChem CID | 9242751 |
| Molecular Formula | C20H24FN6S+ |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-4-[[4-(4-fluorophenyl)piperazin-1-ium-1-yl]methyl]tetrazole-5-thione |
| SMILES | Cc1ccc(-n2nnn(C[NH+]3CCN(c4ccc(F)cc4)CC3)c2=S)cc1C |
| InChI | InChI=1S/C20H23FN6S/c1-15-3-6-19(13-16(15)2)27-20(28)26(22-23-27)14-24-9-11-25(12-10-24)18-7-4-17(21)5-8-18/h3-8,13H,9-12,14H2,1-2H3/p+1 |
| InChIKey | SLQPNFLFLHIILN-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|