C25H24F2N5S+ — CID 2349421
5-(4-fluorophenyl)-2-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 2349421) has the molecular formula C25H24F2N5S+ and a molecular weight of 464.57 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-fluorophenyl)-2-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2349421 |
| Molecular Formula | C25H24F2N5S+ |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 5-(4-fluorophenyl)-2-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | Fc1ccc(-c2nn(C[NH+]3CCN(c4ccccc4F)CC3)c(=S)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23F2N5S/c26-20-12-10-19(11-13-20)24-28-31(25(33)32(24)21-6-2-1-3-7-21)18-29-14-16-30(17-15-29)23-9-5-4-8-22(23)27/h1-13H,14-18H2/p+1 |
| InChIKey | NXAIAIWZLHVMHQ-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 30.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|