C24H26N5O3S2+ — CID 2426659
5-(furan-2-yl)-2-[[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 2426659) has the molecular formula C24H26N5O3S2+ and a molecular weight of 496.64 g/mol. Its IUPAC name is 5-(furan-2-yl)-2-[[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 5-(furan-2-yl)-2-[[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2426659 |
| Molecular Formula | C24H26N5O3S2+ |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 5-(furan-2-yl)-2-[[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+](Cn3nc(-c4ccco4)n(-c4ccccc4)c3=S)CC2)cc1 |
| InChI | InChI=1S/C24H25N5O3S2/c1-19-9-11-21(12-10-19)34(30,31)27-15-13-26(14-16-27)18-28-24(33)29(20-6-3-2-4-7-20)23(25-28)22-8-5-17-32-22/h2-12,17H,13-16,18H2,1H3/p+1 |
| InChIKey | PRBADPMMVXWQCC-UHFFFAOYSA-O |
| XLogP | 2.52 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|