C17H24N5O4S+ — CID 2641596
1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-(4-methylphenyl)sulfonylpiperazin-1-ium (PubChem CID 2641596) has the molecular formula C17H24N5O4S+ and a molecular weight of 394.48 g/mol. Its IUPAC name is 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-(4-methylphenyl)sulfonylpiperazin-1-ium.
| Compound Name | 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-(4-methylphenyl)sulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 2641596 |
| Molecular Formula | C17H24N5O4S+ |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]-4-(4-methylphenyl)sulfonylpiperazin-1-ium |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+](Cn3nc(C)c([N+](=O)[O-])c3C)CC2)cc1 |
| InChI | InChI=1S/C17H23N5O4S/c1-13-4-6-16(7-5-13)27(25,26)20-10-8-19(9-11-20)12-21-15(3)17(22(23)24)14(2)18-21/h4-7H,8-12H2,1-3H3/p+1 |
| InChIKey | RCDRXCWQHAOYGF-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|