C19H23N6O2S+ — CID 8008676
1-(4-methylphenyl)sulfonyl-4-[(5-phenyltetrazol-2-yl)methyl]piperazin-4-ium (PubChem CID 8008676) has the molecular formula C19H23N6O2S+ and a molecular weight of 399.50 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-4-[(5-phenyltetrazol-2-yl)methyl]piperazin-4-ium.
| Compound Name | 1-(4-methylphenyl)sulfonyl-4-[(5-phenyltetrazol-2-yl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 8008676 |
| Molecular Formula | C19H23N6O2S+ |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-4-[(5-phenyltetrazol-2-yl)methyl]piperazin-4-ium |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+](Cn3nnc(-c4ccccc4)n3)CC2)cc1 |
| InChI | InChI=1S/C19H22N6O2S/c1-16-7-9-18(10-8-16)28(26,27)24-13-11-23(12-14-24)15-25-21-19(20-22-25)17-5-3-2-4-6-17/h2-10H,11-15H2,1H3/p+1 |
| InChIKey | JXXKMNAKLRQLAR-UHFFFAOYSA-O |
| XLogP | 0.20 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |