C20H23N4O3S+ — CID 135849148
2-[[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-3H-quinazolin-4-one (PubChem CID 135849148) has the molecular formula C20H23N4O3S+ and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-[[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135849148 |
| Molecular Formula | C20H23N4O3S+ |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-[[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-3H-quinazolin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+](Cc3nc4ccccc4c(=O)[nH]3)CC2)cc1 |
| InChI | InChI=1S/C20H22N4O3S/c1-15-6-8-16(9-7-15)28(26,27)24-12-10-23(11-13-24)14-19-21-18-5-3-2-4-17(18)20(25)22-19/h2-9H,10-14H2,1H3,(H,21,22,25)/p+1 |
| InChIKey | XLZHIIMVTPJGFF-UHFFFAOYSA-O |
| XLogP | 0.32 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |