C21H21N4OS+ — CID 7911026
benzyl-[[3-(furan-2-yl)-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]-methylazanium (PubChem CID 7911026) has the molecular formula C21H21N4OS+ and a molecular weight of 377.49 g/mol. Its IUPAC name is benzyl-[[3-(furan-2-yl)-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]-methylazanium.
| Compound Name | benzyl-[[3-(furan-2-yl)-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]-methylazanium |
|---|---|
| PubChem CID | 7911026 |
| Molecular Formula | C21H21N4OS+ |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | benzyl-[[3-(furan-2-yl)-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]-methylazanium |
| SMILES | C[NH+](Cc1ccccc1)Cn1nc(-c2ccco2)n(-c2ccccc2)c1=S |
| InChI | InChI=1S/C21H20N4OS/c1-23(15-17-9-4-2-5-10-17)16-24-21(27)25(18-11-6-3-7-12-18)20(22-24)19-13-8-14-26-19/h2-14H,15-16H2,1H3/p+1 |
| InChIKey | JSQPZJPJDZZTJY-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 40.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|