C15H15N3OS — CID 2451643
3-(furan-2-yl)-4-phenyl-5-propylsulfanyl-1,2,4-triazole (PubChem CID 2451643) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is 3-(furan-2-yl)-4-phenyl-5-propylsulfanyl-1,2,4-triazole.
| Compound Name | 3-(furan-2-yl)-4-phenyl-5-propylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 2451643 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 3-(furan-2-yl)-4-phenyl-5-propylsulfanyl-1,2,4-triazole |
| SMILES | CCCSc1nnc(-c2ccco2)n1-c1ccccc1 |
| InChI | InChI=1S/C15H15N3OS/c1-2-11-20-15-17-16-14(13-9-6-10-19-13)18(15)12-7-4-3-5-8-12/h3-10H,2,11H2,1H3 |
| InChIKey | FFJOCCMSPURAJK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |