C17H15F3N4O3S — CID 56583617
2,2,2-trifluoroethyl N-[2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]carbamate (PubChem CID 56583617) has the molecular formula C17H15F3N4O3S and a molecular weight of 412.39 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 56583617 |
| Molecular Formula | C17H15F3N4O3S |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-[[5-(furan-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethyl]carbamate |
| SMILES | O=C(NCCSc1nnc(-c2ccco2)n1-c1ccccc1)OCC(F)(F)F |
| InChI | InChI=1S/C17H15F3N4O3S/c18-17(19,20)11-27-16(25)21-8-10-28-15-23-22-14(13-7-4-9-26-13)24(15)12-5-2-1-3-6-12/h1-7,9H,8,10-11H2,(H,21,25) |
| InChIKey | WRANZVHEZAVKLD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|