C17H20F3N5O3S — CID 56529176
2,2,2-trifluoroethyl N-[2-[(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]carbamate (PubChem CID 56529176) has the molecular formula C17H20F3N5O3S and a molecular weight of 431.44 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-[(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-[(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 56529176 |
| Molecular Formula | C17H20F3N5O3S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-[(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]carbamate |
| SMILES | O=C(NCCSc1nnc(N2CCOCC2)n1-c1ccccc1)OCC(F)(F)F |
| InChI | InChI=1S/C17H20F3N5O3S/c18-17(19,20)12-28-16(26)21-6-11-29-15-23-22-14(24-7-9-27-10-8-24)25(15)13-4-2-1-3-5-13/h1-5H,6-12H2,(H,21,26) |
| InChIKey | AHHHPISJFSFTHB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|