C18H23F3N4O2S — CID 55997404
4-[4-(3-methylphenyl)-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-yl]morpholine (PubChem CID 55997404) has the molecular formula C18H23F3N4O2S and a molecular weight of 416.47 g/mol. Its IUPAC name is 4-[4-(3-methylphenyl)-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-yl]morpholine.
| Compound Name | 4-[4-(3-methylphenyl)-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-yl]morpholine |
|---|---|
| PubChem CID | 55997404 |
| Molecular Formula | C18H23F3N4O2S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 4-[4-(3-methylphenyl)-5-[3-(2,2,2-trifluoroethoxy)propylsulfanyl]-1,2,4-triazol-3-yl]morpholine |
| SMILES | Cc1cccc(-n2c(SCCCOCC(F)(F)F)nnc2N2CCOCC2)c1 |
| InChI | InChI=1S/C18H23F3N4O2S/c1-14-4-2-5-15(12-14)25-16(24-6-9-26-10-7-24)22-23-17(25)28-11-3-8-27-13-18(19,20)21/h2,4-5,12H,3,6-11,13H2,1H3 |
| InChIKey | YSGQQWWIUIWJBW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|