C21H23FN4O2S — CID 40659908
4-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-(3-methylphenyl)-1,2,4-triazol-3-yl]morpholine (PubChem CID 40659908) has the molecular formula C21H23FN4O2S and a molecular weight of 414.51 g/mol. Its IUPAC name is 4-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-(3-methylphenyl)-1,2,4-triazol-3-yl]morpholine.
| Compound Name | 4-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-(3-methylphenyl)-1,2,4-triazol-3-yl]morpholine |
|---|---|
| PubChem CID | 40659908 |
| Molecular Formula | C21H23FN4O2S |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 4-[5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-(3-methylphenyl)-1,2,4-triazol-3-yl]morpholine |
| SMILES | Cc1cccc(-n2c(SCCOc3ccc(F)cc3)nnc2N2CCOCC2)c1 |
| InChI | InChI=1S/C21H23FN4O2S/c1-16-3-2-4-18(15-16)26-20(25-9-11-27-12-10-25)23-24-21(26)29-14-13-28-19-7-5-17(22)6-8-19/h2-8,15H,9-14H2,1H3 |
| InChIKey | OKOJDLWZDBZSHS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|