C21H24N4O2S — CID 40659884
4-[4-(3-methylphenyl)-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]morpholine (PubChem CID 40659884) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 4-[4-(3-methylphenyl)-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]morpholine.
| Compound Name | 4-[4-(3-methylphenyl)-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]morpholine |
|---|---|
| PubChem CID | 40659884 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-[4-(3-methylphenyl)-5-(2-phenoxyethylsulfanyl)-1,2,4-triazol-3-yl]morpholine |
| SMILES | Cc1cccc(-n2c(SCCOc3ccccc3)nnc2N2CCOCC2)c1 |
| InChI | InChI=1S/C21H24N4O2S/c1-17-6-5-7-18(16-17)25-20(24-10-12-26-13-11-24)22-23-21(25)28-15-14-27-19-8-3-2-4-9-19/h2-9,16H,10-15H2,1H3 |
| InChIKey | UVKAJJWQAORZFB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|