C23H22ClN5OS — CID 27762605
4-[5-[(2-chloroquinolin-3-yl)methylsulfanyl]-4-(3-methylphenyl)-1,2,4-triazol-3-yl]morpholine (PubChem CID 27762605) has the molecular formula C23H22ClN5OS and a molecular weight of 451.98 g/mol. Its IUPAC name is 4-[5-[(2-chloroquinolin-3-yl)methylsulfanyl]-4-(3-methylphenyl)-1,2,4-triazol-3-yl]morpholine.
| Compound Name | 4-[5-[(2-chloroquinolin-3-yl)methylsulfanyl]-4-(3-methylphenyl)-1,2,4-triazol-3-yl]morpholine |
|---|---|
| PubChem CID | 27762605 |
| Molecular Formula | C23H22ClN5OS |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | 4-[5-[(2-chloroquinolin-3-yl)methylsulfanyl]-4-(3-methylphenyl)-1,2,4-triazol-3-yl]morpholine |
| SMILES | Cc1cccc(-n2c(SCc3cc4ccccc4nc3Cl)nnc2N2CCOCC2)c1 |
| InChI | InChI=1S/C23H22ClN5OS/c1-16-5-4-7-19(13-16)29-22(28-9-11-30-12-10-28)26-27-23(29)31-15-18-14-17-6-2-3-8-20(17)25-21(18)24/h2-8,13-14H,9-12,15H2,1H3 |
| InChIKey | CPIVYGYWBYUHOE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|