C20H17ClN4S — CID 9458418
2-chloro-3-[[5-methyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]quinoline (PubChem CID 9458418) has the molecular formula C20H17ClN4S and a molecular weight of 380.90 g/mol. Its IUPAC name is 2-chloro-3-[[5-methyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]quinoline.
| Compound Name | 2-chloro-3-[[5-methyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]quinoline |
|---|---|
| PubChem CID | 9458418 |
| Molecular Formula | C20H17ClN4S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-chloro-3-[[5-methyl-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]quinoline |
| SMILES | Cc1cccc(-n2c(C)nnc2SCc2cc3ccccc3nc2Cl)c1 |
| InChI | InChI=1S/C20H17ClN4S/c1-13-6-5-8-17(10-13)25-14(2)23-24-20(25)26-12-16-11-15-7-3-4-9-18(15)22-19(16)21/h3-11H,12H2,1-2H3 |
| InChIKey | JILCRPDBILPXJS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|