C18H15ClN4OS — CID 29383204
2-chloro-3-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]quinoline (PubChem CID 29383204) has the molecular formula C18H15ClN4OS and a molecular weight of 370.87 g/mol. Its IUPAC name is 2-chloro-3-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]quinoline.
| Compound Name | 2-chloro-3-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]quinoline |
|---|---|
| PubChem CID | 29383204 |
| Molecular Formula | C18H15ClN4OS |
| Molecular Weight | 370.87 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 2-chloro-3-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanylmethyl]quinoline |
| SMILES | CCn1c(SCc2cc3ccccc3nc2Cl)nnc1-c1ccco1 |
| InChI | InChI=1S/C18H15ClN4OS/c1-2-23-17(15-8-5-9-24-15)21-22-18(23)25-11-13-10-12-6-3-4-7-14(12)20-16(13)19/h3-10H,2,11H2,1H3 |
| InChIKey | FSKXWHQAVLANOG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.87 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|