C18H13ClFN5S — CID 7594891
3-[(2-chloroquinolin-3-yl)methylsulfanyl]-5-(3-fluorophenyl)-1,2,4-triazol-4-amine (PubChem CID 7594891) has the molecular formula C18H13ClFN5S and a molecular weight of 385.86 g/mol. Its IUPAC name is 3-[(2-chloroquinolin-3-yl)methylsulfanyl]-5-(3-fluorophenyl)-1,2,4-triazol-4-amine.
| Compound Name | 3-[(2-chloroquinolin-3-yl)methylsulfanyl]-5-(3-fluorophenyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 7594891 |
| Molecular Formula | C18H13ClFN5S |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 3-[(2-chloroquinolin-3-yl)methylsulfanyl]-5-(3-fluorophenyl)-1,2,4-triazol-4-amine |
| SMILES | Nn1c(SCc2cc3ccccc3nc2Cl)nnc1-c1cccc(F)c1 |
| InChI | InChI=1S/C18H13ClFN5S/c19-16-13(8-11-4-1-2-7-15(11)22-16)10-26-18-24-23-17(25(18)21)12-5-3-6-14(20)9-12/h1-9H,10,21H2 |
| InChIKey | PIJOMFYSUZTIAT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|