C17H19N4S+ — CID 2402529
(3,4-diphenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl-dimethylazanium (PubChem CID 2402529) has the molecular formula C17H19N4S+ and a molecular weight of 311.43 g/mol. Its IUPAC name is (3,4-diphenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl-dimethylazanium.
| Compound Name | (3,4-diphenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl-dimethylazanium |
|---|---|
| PubChem CID | 2402529 |
| Molecular Formula | C17H19N4S+ |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (3,4-diphenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl-dimethylazanium |
| SMILES | C[NH+](C)Cn1nc(-c2ccccc2)n(-c2ccccc2)c1=S |
| InChI | InChI=1S/C17H18N4S/c1-19(2)13-20-17(22)21(15-11-7-4-8-12-15)16(18-20)14-9-5-3-6-10-14/h3-12H,13H2,1-2H3/p+1 |
| InChIKey | FLNLLPBUXDRIEM-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 27.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|