C16H15N3OS — CID 10709139
5-(4-methoxyphenyl)-2-methyl-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 10709139) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-methyl-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-methoxyphenyl)-2-methyl-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 10709139 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-methyl-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(-c2nn(C)c(=S)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H15N3OS/c1-18-16(21)19(13-6-4-3-5-7-13)15(17-18)12-8-10-14(20-2)11-9-12/h3-11H,1-2H3 |
| InChIKey | UCCCEYXBAWKKBG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 31.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|