C11H13N3O2 — CID 3682674
4-(4-methoxyphenyl)-2,5-dimethyl-1,2,4-triazol-3-one (PubChem CID 3682674) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,5-dimethyl-1,2,4-triazol-3-one.
| Compound Name | 4-(4-methoxyphenyl)-2,5-dimethyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 3682674 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,5-dimethyl-1,2,4-triazol-3-one |
| SMILES | COc1ccc(-n2c(C)nn(C)c2=O)cc1 |
| InChI | InChI=1S/C11H13N3O2/c1-8-12-13(2)11(15)14(8)9-4-6-10(16-3)7-5-9/h4-7H,1-3H3 |
| InChIKey | PDKVYNYYUVFFNX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |