About 1-(4-methoxyphenyl)-4,6-dimethylpyrimidin-2-one;hydrochloride
1-(4-methoxyphenyl)-4,6-dimethylpyrimidin-2-one;hydrochloride (PubChem CID 5337650) has the molecular formula C13H15ClN2O2
and a molecular weight of 266.73 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4,6-dimethylpyrimidin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 1-(4-methoxyphenyl)-4,6-dimethylpyrimidin-2-one;hydrochloride |
| PubChem CID | 5337650 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1-(4-methoxyphenyl)-4,6-dimethylpyrimidin-2-one;hydrochloride |
| SMILES | COc1ccc(-n2c(C)cc(C)nc2=O)cc1.Cl |
| InChI | InChI=1S/C13H14N2O2.ClH/c1-9-8-10(2)15(13(16)14-9)11-4-6-12(17-3)7-5-11;/h4-8H,1-3H3;1H |
| InChIKey | DRPSVXJWFIHOBW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methoxyphenyl)-4,6-dimethylpyrimidin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenyl)-4,6-dimethylpyrimidin-2-one;hydrochloride?
The IUPAC name of 1-(4-methoxyphenyl)-4,6-dimethylpyrimidin-2-one;hydrochloride (CID 5337650) is 1-(4-methoxyphenyl)-4,6-dimethylpyrimidin-2-one;hydrochloride.
What is the SMILES notation for 1-(4-methoxyphenyl)-4,6-dimethylpyrimidin-2-one;hydrochloride?
The canonical SMILES for 1-(4-methoxyphenyl)-4,6-dimethylpyrimidin-2-one;hydrochloride is COc1ccc(-n2c(C)cc(C)nc2=O)cc1.Cl.
What is the InChIKey of 1-(4-methoxyphenyl)-4,6-dimethylpyrimidin-2-one;hydrochloride?
The InChIKey is DRPSVXJWFIHOBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2.ClH/c1-9-8-10(2)15(13(16)14-9)11-4-6-12(17-3)7-5-11;/h4-8H,1-3H3;1H.
What are the key properties of 1-(4-methoxyphenyl)-4,6-dimethylpyrimidin-2-one;hydrochloride?
1-(4-methoxyphenyl)-4,6-dimethylpyrimidin-2-one;hydrochloride has a molecular weight of 266.73 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenyl)-4,6-dimethylpyrimidin-2-one;hydrochloride is sourced from PubChem (CID 5337650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).