C15H14N4S — CID 14472445
5-anilino-2-methyl-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 14472445) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is 5-anilino-2-methyl-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 5-anilino-2-methyl-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 14472445 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 5-anilino-2-methyl-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | Cn1nc(Nc2ccccc2)n(-c2ccccc2)c1=S |
| InChI | InChI=1S/C15H14N4S/c1-18-15(20)19(13-10-6-3-7-11-13)14(17-18)16-12-8-4-2-5-9-12/h2-11H,1H3,(H,16,17) |
| InChIKey | IIOWBUGNGHJQAI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 34.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|