C20H15N5S — CID 102194730
6-anilino-1-phenyl-4-pyridin-3-yl-1,3,5-triazine-2-thione (PubChem CID 102194730) has the molecular formula C20H15N5S and a molecular weight of 357.44 g/mol. Its IUPAC name is 6-anilino-1-phenyl-4-pyridin-3-yl-1,3,5-triazine-2-thione.
| Compound Name | 6-anilino-1-phenyl-4-pyridin-3-yl-1,3,5-triazine-2-thione |
|---|---|
| PubChem CID | 102194730 |
| Molecular Formula | C20H15N5S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 6-anilino-1-phenyl-4-pyridin-3-yl-1,3,5-triazine-2-thione |
| SMILES | S=c1nc(-c2cccnc2)nc(Nc2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C20H15N5S/c26-20-24-18(15-8-7-13-21-14-15)23-19(22-16-9-3-1-4-10-16)25(20)17-11-5-2-6-12-17/h1-14H,(H,22,23,24,26) |
| InChIKey | ZYCLFUZYZAHNNL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|