C20H18N4O3S — CID 11865324
(1R,2R,5S)-2-(3-anilino-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 11865324) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is (1R,2R,5S)-2-(3-anilino-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | (1R,2R,5S)-2-(3-anilino-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 11865324 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (1R,2R,5S)-2-(3-anilino-4-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | O=C1C[C@@H](n2nc(Nc3ccccc3)n(-c3ccccc3)c2=S)[C@@H]2CO[C@H]1O2 |
| InChI | InChI=1S/C20H18N4O3S/c25-16-11-15(17-12-26-18(16)27-17)24-20(28)23(14-9-5-2-6-10-14)19(22-24)21-13-7-3-1-4-8-13/h1-10,15,17-18H,11-12H2,(H,21,22)/t15-,17+,18+/m1/s1 |
| InChIKey | VETSUJWTOQSCMW-NJAFHUGGSA-N |
| XLogP | 3.40 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|