C33H31N7S2 — CID 4288030
2-[[(3,4-diphenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl-propylamino]methyl]-4,5-diphenyl-1,2,4-triazole-3-thione (PubChem CID 4288030) has the molecular formula C33H31N7S2 and a molecular weight of 589.79 g/mol. Its IUPAC name is 2-[[(3,4-diphenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl-propylamino]methyl]-4,5-diphenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(3,4-diphenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl-propylamino]methyl]-4,5-diphenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 4288030 |
| Molecular Formula | C33H31N7S2 |
| Molecular Weight | 589.79 g/mol |
| Exact Mass | 589.21 |
| IUPAC Name | 2-[[(3,4-diphenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl-propylamino]methyl]-4,5-diphenyl-1,2,4-triazole-3-thione |
| SMILES | CCCN(Cn1nc(-c2ccccc2)n(-c2ccccc2)c1=S)Cn1nc(-c2ccccc2)n(-c2ccccc2)c1=S |
| InChI | InChI=1S/C33H31N7S2/c1-2-23-36(24-37-32(41)39(28-19-11-5-12-20-28)30(34-37)26-15-7-3-8-16-26)25-38-33(42)40(29-21-13-6-14-22-29)31(35-38)27-17-9-4-10-18-27/h3-22H,2,23-25H2,1H3 |
| InChIKey | DQEGAPFAPLDOAE-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 48.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.79 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|