C21H27N5S — CID 94688495
2-[[benzyl(propyl)amino]methyl]-4-propyl-5-pyridin-4-yl-1,2,4-triazole-3-thione (PubChem CID 94688495) has the molecular formula C21H27N5S and a molecular weight of 381.55 g/mol. Its IUPAC name is 2-[[benzyl(propyl)amino]methyl]-4-propyl-5-pyridin-4-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[benzyl(propyl)amino]methyl]-4-propyl-5-pyridin-4-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 94688495 |
| Molecular Formula | C21H27N5S |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 2-[[benzyl(propyl)amino]methyl]-4-propyl-5-pyridin-4-yl-1,2,4-triazole-3-thione |
| SMILES | CCCN(Cc1ccccc1)Cn1nc(-c2ccncc2)n(CCC)c1=S |
| InChI | InChI=1S/C21H27N5S/c1-3-14-24(16-18-8-6-5-7-9-18)17-26-21(27)25(15-4-2)20(23-26)19-10-12-22-13-11-19/h5-13H,3-4,14-17H2,1-2H3 |
| InChIKey | KLCFUUURYLUVPR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|