C22H26N4O2S — CID 18081616
2-[[benzyl(propyl)amino]methyl]-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazole-3-thione (PubChem CID 18081616) has the molecular formula C22H26N4O2S and a molecular weight of 410.54 g/mol. Its IUPAC name is 2-[[benzyl(propyl)amino]methyl]-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[benzyl(propyl)amino]methyl]-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 18081616 |
| Molecular Formula | C22H26N4O2S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-[[benzyl(propyl)amino]methyl]-5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-1,2,4-triazole-3-thione |
| SMILES | CCCN(Cc1ccccc1)Cn1nc(C2COc3ccccc3O2)n(C)c1=S |
| InChI | InChI=1S/C22H26N4O2S/c1-3-13-25(14-17-9-5-4-6-10-17)16-26-22(29)24(2)21(23-26)20-15-27-18-11-7-8-12-19(18)28-20/h4-12,20H,3,13-16H2,1-2H3 |
| InChIKey | GMMNLRIHUZSAEA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 44.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|