C23H26N4O2S — CID 42937060
5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-2-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-1,2,4-triazole-3-thione (PubChem CID 42937060) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-2-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-2-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 42937060 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-methyl-2-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-1,2,4-triazole-3-thione |
| SMILES | CN(Cn1nc(C2COc3ccccc3O2)n(C)c1=S)C1CCCc2ccccc21 |
| InChI | InChI=1S/C23H26N4O2S/c1-25(18-11-7-9-16-8-3-4-10-17(16)18)15-27-23(30)26(2)22(24-27)21-14-28-19-12-5-6-13-20(19)29-21/h3-6,8,10,12-13,18,21H,7,9,11,14-15H2,1-2H3 |
| InChIKey | HXUQNQNSBWEKRE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|