C20H21ClN4S — CID 24650823
5-(4-chlorophenyl)-2-[[2,3-dihydro-1H-inden-1-yl(methyl)amino]methyl]-4-methyl-1,2,4-triazole-3-thione (PubChem CID 24650823) has the molecular formula C20H21ClN4S and a molecular weight of 384.94 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[2,3-dihydro-1H-inden-1-yl(methyl)amino]methyl]-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-chlorophenyl)-2-[[2,3-dihydro-1H-inden-1-yl(methyl)amino]methyl]-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 24650823 |
| Molecular Formula | C20H21ClN4S |
| Molecular Weight | 384.94 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[2,3-dihydro-1H-inden-1-yl(methyl)amino]methyl]-4-methyl-1,2,4-triazole-3-thione |
| SMILES | CN(Cn1nc(-c2ccc(Cl)cc2)n(C)c1=S)C1CCc2ccccc21 |
| InChI | InChI=1S/C20H21ClN4S/c1-23(18-12-9-14-5-3-4-6-17(14)18)13-25-20(26)24(2)19(22-25)15-7-10-16(21)11-8-15/h3-8,10-11,18H,9,12-13H2,1-2H3 |
| InChIKey | VMUPQZXNMGBACX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.94 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|