C24H28N4OS — CID 47089126
2-[[cyclopropyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-5-(4-methoxyphenyl)-4-methyl-1,2,4-triazole-3-thione (PubChem CID 47089126) has the molecular formula C24H28N4OS and a molecular weight of 420.58 g/mol. Its IUPAC name is 2-[[cyclopropyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-5-(4-methoxyphenyl)-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[cyclopropyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-5-(4-methoxyphenyl)-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 47089126 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 2-[[cyclopropyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-5-(4-methoxyphenyl)-4-methyl-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(-c2nn(CN(C3CC3)C3CCCc4ccccc43)c(=S)n2C)cc1 |
| InChI | InChI=1S/C24H28N4OS/c1-26-23(18-10-14-20(29-2)15-11-18)25-28(24(26)30)16-27(19-12-13-19)22-9-5-7-17-6-3-4-8-21(17)22/h3-4,6,8,10-11,14-15,19,22H,5,7,9,12-13,16H2,1-2H3 |
| InChIKey | OPZVJZACBPMJSH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|