C22H30N4O2S2 — CID 98730593
2-[[cyclopropyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]-5-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-4-methyl-1,2,4-triazole-3-thione (PubChem CID 98730593) has the molecular formula C22H30N4O2S2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 2-[[cyclopropyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]-5-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[cyclopropyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]-5-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 98730593 |
| Molecular Formula | C22H30N4O2S2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-[[cyclopropyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]methyl]-5-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-4-methyl-1,2,4-triazole-3-thione |
| SMILES | Cn1c(C[C@H]2CCS(=O)(=O)C2)nn(CN(C2CC2)[C@@H]2CCCc3ccccc32)c1=S |
| InChI | InChI=1S/C22H30N4O2S2/c1-24-21(13-16-11-12-30(27,28)14-16)23-26(22(24)29)15-25(18-9-10-18)20-8-4-6-17-5-2-3-7-19(17)20/h2-3,5,7,16,18,20H,4,6,8-15H2,1H3/t16-,20-/m1/s1 |
| InChIKey | WBAMFZUQMZUSGX-OXQOHEQNSA-N |
| XLogP | 3.43 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|