C20H27N4O2S2+ — CID 9236175
5-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-4-methyl-2-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 9236175) has the molecular formula C20H27N4O2S2+ and a molecular weight of 419.60 g/mol. Its IUPAC name is 5-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-4-methyl-2-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-4-methyl-2-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9236175 |
| Molecular Formula | C20H27N4O2S2+ |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 5-[[(3R)-1,1-dioxothiolan-3-yl]methyl]-4-methyl-2-[(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | Cn1c(C[C@@H]2CCS(=O)(=O)C2)nn(C[NH+]2CC=C(c3ccccc3)CC2)c1=S |
| InChI | InChI=1S/C20H26N4O2S2/c1-22-19(13-16-9-12-28(25,26)14-16)21-24(20(22)27)15-23-10-7-18(8-11-23)17-5-3-2-4-6-17/h2-7,16H,8-15H2,1H3/p+1/t16-/m0/s1 |
| InChIKey | QDJBKZMZRVTZKK-INIZCTEOSA-O |
| XLogP | 1.26 |
| TPSA | 61.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|