C21H34N4O2S2 — CID 42962401
2-[[2-adamantyl(ethyl)amino]methyl]-5-[(1,1-dioxothiolan-3-yl)methyl]-4-methyl-1,2,4-triazole-3-thione (PubChem CID 42962401) has the molecular formula C21H34N4O2S2 and a molecular weight of 438.66 g/mol. Its IUPAC name is 2-[[2-adamantyl(ethyl)amino]methyl]-5-[(1,1-dioxothiolan-3-yl)methyl]-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[2-adamantyl(ethyl)amino]methyl]-5-[(1,1-dioxothiolan-3-yl)methyl]-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 42962401 |
| Molecular Formula | C21H34N4O2S2 |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 2-[[2-adamantyl(ethyl)amino]methyl]-5-[(1,1-dioxothiolan-3-yl)methyl]-4-methyl-1,2,4-triazole-3-thione |
| SMILES | CCN(Cn1nc(CC2CCS(=O)(=O)C2)n(C)c1=S)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C21H34N4O2S2/c1-3-24(20-17-7-15-6-16(9-17)10-18(20)8-15)13-25-21(28)23(2)19(22-25)11-14-4-5-29(26,27)12-14/h14-18,20H,3-13H2,1-2H3 |
| InChIKey | URVJKBIPWGXEJF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|