C21H24N4S2 — CID 42937067
4-cyclopropyl-2-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione (PubChem CID 42937067) has the molecular formula C21H24N4S2 and a molecular weight of 396.59 g/mol. Its IUPAC name is 4-cyclopropyl-2-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 4-cyclopropyl-2-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 42937067 |
| Molecular Formula | C21H24N4S2 |
| Molecular Weight | 396.59 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 4-cyclopropyl-2-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione |
| SMILES | CN(Cn1nc(-c2cccs2)n(C2CC2)c1=S)C1CCCc2ccccc21 |
| InChI | InChI=1S/C21H24N4S2/c1-23(18-9-4-7-15-6-2-3-8-17(15)18)14-24-21(26)25(16-11-12-16)20(22-24)19-10-5-13-27-19/h2-3,5-6,8,10,13,16,18H,4,7,9,11-12,14H2,1H3 |
| InChIKey | DOYPUSBOLQMHKB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.59 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|