C20H22N4OS2 — CID 51280562
N-methyl-2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 51280562) has the molecular formula C20H22N4OS2 and a molecular weight of 398.56 g/mol. Its IUPAC name is N-methyl-2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | N-methyl-2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 51280562 |
| Molecular Formula | C20H22N4OS2 |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | N-methyl-2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | CN(C(=O)CSc1nnc(-c2cccs2)n1C)C1CCCc2ccccc21 |
| InChI | InChI=1S/C20H22N4OS2/c1-23(16-10-5-8-14-7-3-4-9-15(14)16)18(25)13-27-20-22-21-19(24(20)2)17-11-6-12-26-17/h3-4,6-7,9,11-12,16H,5,8,10,13H2,1-2H3 |
| InChIKey | MDGDOGXROUERSN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |