C27H27N5OS — CID 41042492
N-methyl-2-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 41042492) has the molecular formula C27H27N5OS and a molecular weight of 469.61 g/mol. Its IUPAC name is N-methyl-2-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | N-methyl-2-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 41042492 |
| Molecular Formula | C27H27N5OS |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | N-methyl-2-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | Cc1ccccc1-n1c(SCC(=O)N(C)[C@H]2CCCc3ccccc32)nnc1-c1cccnc1 |
| InChI | InChI=1S/C27H27N5OS/c1-19-9-3-6-14-23(19)32-26(21-12-8-16-28-17-21)29-30-27(32)34-18-25(33)31(2)24-15-7-11-20-10-4-5-13-22(20)24/h3-6,8-10,12-14,16-17,24H,7,11,15,18H2,1-2H3/t24-/m0/s1 |
| InChIKey | IKMMXMCKFNOYPK-DEOSSOPVSA-N |
| XLogP | 5.27 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |