C14H17N3S2 — CID 42943995
3-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-1,3,4-thiadiazole-2-thione (PubChem CID 42943995) has the molecular formula C14H17N3S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 3-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 42943995 |
| Molecular Formula | C14H17N3S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 3-[[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]methyl]-1,3,4-thiadiazole-2-thione |
| SMILES | CN(Cn1ncsc1=S)C1CCCc2ccccc21 |
| InChI | InChI=1S/C14H17N3S2/c1-16(10-17-14(18)19-9-15-17)13-8-4-6-11-5-2-3-7-12(11)13/h2-3,5,7,9,13H,4,6,8,10H2,1H3 |
| InChIKey | DPCGBFDVEXTGOF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|