C21H28N4S2 — CID 31980262
2-[[2-adamantyl(methyl)amino]methyl]-4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazole-3-thione (PubChem CID 31980262) has the molecular formula C21H28N4S2 and a molecular weight of 400.62 g/mol. Its IUPAC name is 2-[[2-adamantyl(methyl)amino]methyl]-4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[2-adamantyl(methyl)amino]methyl]-4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 31980262 |
| Molecular Formula | C21H28N4S2 |
| Molecular Weight | 400.62 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2-[[2-adamantyl(methyl)amino]methyl]-4-cyclopropyl-5-thiophen-2-yl-1,2,4-triazole-3-thione |
| SMILES | CN(Cn1nc(-c2cccs2)n(C2CC2)c1=S)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C21H28N4S2/c1-23(19-15-8-13-7-14(10-15)11-16(19)9-13)12-24-21(26)25(17-4-5-17)20(22-24)18-3-2-6-27-18/h2-3,6,13-17,19H,4-5,7-12H2,1H3 |
| InChIKey | XUUHIMJFJDKGQZ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|