C19H28N4OS2 — CID 2492806
2-[[cyclohexyl(methyl)amino]methyl]-4-[[(2R)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione (PubChem CID 2492806) has the molecular formula C19H28N4OS2 and a molecular weight of 392.59 g/mol. Its IUPAC name is 2-[[cyclohexyl(methyl)amino]methyl]-4-[[(2R)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[cyclohexyl(methyl)amino]methyl]-4-[[(2R)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2492806 |
| Molecular Formula | C19H28N4OS2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 2-[[cyclohexyl(methyl)amino]methyl]-4-[[(2R)-oxolan-2-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione |
| SMILES | CN(Cn1nc(-c2cccs2)n(C[C@H]2CCCO2)c1=S)C1CCCCC1 |
| InChI | InChI=1S/C19H28N4OS2/c1-21(15-7-3-2-4-8-15)14-23-19(25)22(13-16-9-5-11-24-16)18(20-23)17-10-6-12-26-17/h6,10,12,15-16H,2-5,7-9,11,13-14H2,1H3/t16-/m1/s1 |
| InChIKey | BIENZMFMJWPTHR-MRXNPFEDSA-N |
| XLogP | 4.54 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|