C16H23N5S2 — CID 95635128
4-cyclopropyl-2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione (PubChem CID 95635128) has the molecular formula C16H23N5S2 and a molecular weight of 349.53 g/mol. Its IUPAC name is 4-cyclopropyl-2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione.
| Compound Name | 4-cyclopropyl-2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 95635128 |
| Molecular Formula | C16H23N5S2 |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 4-cyclopropyl-2-[[(2S)-2,4-dimethylpiperazin-1-yl]methyl]-5-thiophen-2-yl-1,2,4-triazole-3-thione |
| SMILES | C[C@H]1CN(C)CCN1Cn1nc(-c2cccs2)n(C2CC2)c1=S |
| InChI | InChI=1S/C16H23N5S2/c1-12-10-18(2)7-8-19(12)11-20-16(22)21(13-5-6-13)15(17-20)14-4-3-9-23-14/h3-4,9,12-13H,5-8,10-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | TWYPQQBALIZUEJ-LBPRGKRZSA-N |
| XLogP | 3.07 |
| TPSA | 29.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|