C24H24N4OS — CID 24650811
4-benzyl-2-[[2,3-dihydro-1H-inden-1-yl(methyl)amino]methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione (PubChem CID 24650811) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is 4-benzyl-2-[[2,3-dihydro-1H-inden-1-yl(methyl)amino]methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione.
| Compound Name | 4-benzyl-2-[[2,3-dihydro-1H-inden-1-yl(methyl)amino]methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 24650811 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-benzyl-2-[[2,3-dihydro-1H-inden-1-yl(methyl)amino]methyl]-5-(furan-2-yl)-1,2,4-triazole-3-thione |
| SMILES | CN(Cn1nc(-c2ccco2)n(Cc2ccccc2)c1=S)C1CCc2ccccc21 |
| InChI | InChI=1S/C24H24N4OS/c1-26(21-14-13-19-10-5-6-11-20(19)21)17-28-24(30)27(16-18-8-3-2-4-9-18)23(25-28)22-12-7-15-29-22/h2-12,15,21H,13-14,16-17H2,1H3 |
| InChIKey | XDHMVWNUEXQYBN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 39.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|